About 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione
2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione (PubChem CID 3982441) has the molecular formula C22H12N2O6
and a molecular weight of 400.35 g/mol. Its IUPAC name is 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione |
| PubChem CID | 3982441 |
| Molecular Formula | C22H12N2O6 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione |
| SMILES | O=C1C=CC(=NOC2=C(ON=C3C=CC(=O)C=C3)C(=O)c3ccccc3C2=O)C=C1 |
| InChI | InChI=1S/C22H12N2O6/c25-15-9-5-13(6-10-15)23-29-21-19(27)17-3-1-2-4-18(17)20(28)22(21)30-24-14-7-11-16(26)12-8-14/h1-12H |
| InChIKey | NEPWTTFZTSHAHW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione?
The IUPAC name of 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione (CID 3982441) is 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione.
What is the SMILES notation for 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione?
The canonical SMILES for 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione is O=C1C=CC(=NOC2=C(ON=C3C=CC(=O)C=C3)C(=O)c3ccccc3C2=O)C=C1.
What is the InChIKey of 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione?
The InChIKey is NEPWTTFZTSHAHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12N2O6/c25-15-9-5-13(6-10-15)23-29-21-19(27)17-3-1-2-4-18(17)20(28)22(21)30-24-14-7-11-16(26)12-8-14/h1-12H.
What are the key properties of 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione?
2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione has a molecular weight of 400.35 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis[[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]oxy]naphthalene-1,4-dione is sourced from PubChem (CID 3982441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).