About 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea
1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea (PubChem CID 3983204) has the molecular formula C17H19N3O3S
and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea.
Molecular Properties
| Compound Name | 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea |
| PubChem CID | 3983204 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(C=NNC(=S)NCc2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C17H19N3O3S/c1-22-14-8-13(9-15(23-2)16(14)21)11-19-20-17(24)18-10-12-6-4-3-5-7-12/h3-9,11,21H,10H2,1-2H3,(H2,18,20,24) |
| InChIKey | BVGPHYDJXNZCHC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea?
The IUPAC name of 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea (CID 3983204) is 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea.
What is the SMILES notation for 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea?
The canonical SMILES for 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea is COc1cc(C=NNC(=S)NCc2ccccc2)cc(OC)c1O.
What is the InChIKey of 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea?
The InChIKey is BVGPHYDJXNZCHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3S/c1-22-14-8-13(9-15(23-2)16(14)21)11-19-20-17(24)18-10-12-6-4-3-5-7-12/h3-9,11,21H,10H2,1-2H3,(H2,18,20,24).
What are the key properties of 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea?
1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea has a molecular weight of 345.42 g/mol, XLogP of 2.41, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]thiourea is sourced from PubChem (CID 3983204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).