C19H18ClN3O3S — CID 39833326
4-chloro-N,N-dimethyl-3-[(3-methylquinolin-8-yl)sulfonylamino]benzamide (PubChem CID 39833326) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-3-[(3-methylquinolin-8-yl)sulfonylamino]benzamide.
| Compound Name | 4-chloro-N,N-dimethyl-3-[(3-methylquinolin-8-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 39833326 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 4-chloro-N,N-dimethyl-3-[(3-methylquinolin-8-yl)sulfonylamino]benzamide |
| SMILES | Cc1cnc2c(S(=O)(=O)Nc3cc(C(=O)N(C)C)ccc3Cl)cccc2c1 |
| InChI | InChI=1S/C19H18ClN3O3S/c1-12-9-13-5-4-6-17(18(13)21-11-12)27(25,26)22-16-10-14(7-8-15(16)20)19(24)23(2)3/h4-11,22H,1-3H3 |
| InChIKey | FWULQUJFIPNPFX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |