About (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine
(3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine (PubChem CID 39834526) has the molecular formula C19H40N2O2
and a molecular weight of 328.54 g/mol. Its IUPAC name is (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine.
Molecular Properties
| Compound Name | (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine |
| PubChem CID | 39834526 |
| Molecular Formula | C19H40N2O2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine |
| SMILES | COC(C)(C)CCC[C@H](C)CCNCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C19H40N2O2/c1-17(8-7-10-19(4,5)22-6)9-11-20-16-18(2,3)21-12-14-23-15-13-21/h17,20H,7-16H2,1-6H3/t17-/m0/s1 |
| InChIKey | RXXISCONORGZAZ-KRWDZBQOSA-N |
| XLogP | 3.31 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine?
The IUPAC name of (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine (CID 39834526) is (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine.
What is the SMILES notation for (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine?
The canonical SMILES for (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine is COC(C)(C)CCC[C@H](C)CCNCC(C)(C)N1CCOCC1.
What is the InChIKey of (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine?
The InChIKey is RXXISCONORGZAZ-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H40N2O2/c1-17(8-7-10-19(4,5)22-6)9-11-20-16-18(2,3)21-12-14-23-15-13-21/h17,20H,7-16H2,1-6H3/t17-/m0/s1.
What are the key properties of (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine?
(3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine has a molecular weight of 328.54 g/mol, XLogP of 3.31, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7-methoxy-3,7-dimethyl-N-(2-methyl-2-morpholin-4-ylpropyl)octan-1-amine is sourced from PubChem (CID 39834526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).