C19H19NO4S2 — CID 39836129
2-[2-[(1S,2R,9S,10R,11R)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-9-yl]phenoxy]acetic acid (PubChem CID 39836129) has the molecular formula C19H19NO4S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[2-[(1S,2R,9S,10R,11R)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-9-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(1S,2R,9S,10R,11R)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-9-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 39836129 |
| Molecular Formula | C19H19NO4S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-[2-[(1S,2R,9S,10R,11R)-6-oxo-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-9-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1[C@H]1c2sc(=O)[nH]c2S[C@@H]2[C@H]3CC[C@H](C3)[C@H]12 |
| InChI | InChI=1S/C19H19NO4S2/c21-13(22)8-24-12-4-2-1-3-11(12)15-14-9-5-6-10(7-9)16(14)25-18-17(15)26-19(23)20-18/h1-4,9-10,14-16H,5-8H2,(H,20,23)(H,21,22)/t9-,10+,14-,15-,16-/m1/s1 |
| InChIKey | ABUCYUCRHBTIDC-BZYYHXKRSA-N |
| XLogP | 3.55 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|