C21H16ClNO3S2 — CID 39840272
(1S,10R)-14-[2-(4-chlorophenyl)-2-oxoethyl]-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-15-one (PubChem CID 39840272) has the molecular formula C21H16ClNO3S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is (1S,10R)-14-[2-(4-chlorophenyl)-2-oxoethyl]-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-15-one.
| Compound Name | (1S,10R)-14-[2-(4-chlorophenyl)-2-oxoethyl]-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-15-one |
|---|---|
| PubChem CID | 39840272 |
| Molecular Formula | C21H16ClNO3S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | (1S,10R)-14-[2-(4-chlorophenyl)-2-oxoethyl]-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-15-one |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H]1c3ccccc3OC[C@@H]1CS2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClNO3S2/c22-14-7-5-12(6-8-14)16(24)9-23-20-19(28-21(23)25)18-13(11-27-20)10-26-17-4-2-1-3-15(17)18/h1-8,13,18H,9-11H2/t13-,18+/m1/s1 |
| InChIKey | IDPAFACLHAHOLN-ACJLOTCBSA-N |
| XLogP | 4.69 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|