C16H18N4O6S2 — CID 39840446
(2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-[6-[[(2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]hexyl]acetamide (PubChem CID 39840446) has the molecular formula C16H18N4O6S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-[6-[[(2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]hexyl]acetamide.
| Compound Name | (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-[6-[[(2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]hexyl]acetamide |
|---|---|
| PubChem CID | 39840446 |
| Molecular Formula | C16H18N4O6S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-[6-[[(2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]hexyl]acetamide |
| SMILES | O=C(/C=C1/SC(=O)NC1=O)NCCCCCCNC(=O)/C=C1/SC(=O)NC1=O |
| InChI | InChI=1S/C16H18N4O6S2/c21-11(7-9-13(23)19-15(25)27-9)17-5-3-1-2-4-6-18-12(22)8-10-14(24)20-16(26)28-10/h7-8H,1-6H2,(H,17,21)(H,18,22)(H,19,23,25)(H,20,24,26)/b9-7+,10-8+ |
| InChIKey | MKYKVWUEYSGFGH-FIFLTTCUSA-N |
| XLogP | 0.51 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|