C21H13NO4S2 — CID 39840503
(17R)-17-(4-methoxyphenyl)-11,15-dithia-13-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3,5,7,12(16)-pentaene-2,9,14-trione (PubChem CID 39840503) has the molecular formula C21H13NO4S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is (17R)-17-(4-methoxyphenyl)-11,15-dithia-13-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3,5,7,12(16)-pentaene-2,9,14-trione.
| Compound Name | (17R)-17-(4-methoxyphenyl)-11,15-dithia-13-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3,5,7,12(16)-pentaene-2,9,14-trione |
|---|---|
| PubChem CID | 39840503 |
| Molecular Formula | C21H13NO4S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | (17R)-17-(4-methoxyphenyl)-11,15-dithia-13-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3,5,7,12(16)-pentaene-2,9,14-trione |
| SMILES | COc1ccc([C@@H]2C3=C(Sc4[nH]c(=O)sc42)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C21H13NO4S2/c1-26-11-8-6-10(7-9-11)14-15-16(23)12-4-2-3-5-13(12)17(24)18(15)27-20-19(14)28-21(25)22-20/h2-9,14H,1H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | LEDNGVMKAKHNRV-CQSZACIVSA-N |
| XLogP | 4.02 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|