C8H7NO2S2 — CID 39840667
(5R)-5-methyl-2-oxo-3,5-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde (PubChem CID 39840667) has the molecular formula C8H7NO2S2 and a molecular weight of 213.28 g/mol. Its IUPAC name is (5R)-5-methyl-2-oxo-3,5-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde.
| Compound Name | (5R)-5-methyl-2-oxo-3,5-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 39840667 |
| Molecular Formula | C8H7NO2S2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | (5R)-5-methyl-2-oxo-3,5-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde |
| SMILES | C[C@H]1Sc2[nH]c(=O)sc2C=C1C=O |
| InChI | InChI=1S/C8H7NO2S2/c1-4-5(3-10)2-6-7(12-4)9-8(11)13-6/h2-4H,1H3,(H,9,11)/t4-/m1/s1 |
| InChIKey | BLZIKNPBRRKUMQ-SCSAIBSYSA-N |
| XLogP | 1.51 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|