C13H15F3N2O — CID 3984147
4-(2,2-dimethylhydrazinyl)-1,1,1-trifluoro-4-(4-methylphenyl)but-3-en-2-one (PubChem CID 3984147) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-1,1,1-trifluoro-4-(4-methylphenyl)but-3-en-2-one.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-1,1,1-trifluoro-4-(4-methylphenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 3984147 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-1,1,1-trifluoro-4-(4-methylphenyl)but-3-en-2-one |
| SMILES | Cc1ccc(C(=CC(=O)C(F)(F)F)NN(C)C)cc1 |
| InChI | InChI=1S/C13H15F3N2O/c1-9-4-6-10(7-5-9)11(17-18(2)3)8-12(19)13(14,15)16/h4-8,17H,1-3H3 |
| InChIKey | DPLFJOFTMVDGHW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|