About [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate (PubChem CID 3984161) has the molecular formula C22H27N3O4
and a molecular weight of 397.48 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate.
Molecular Properties
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate |
| PubChem CID | 3984161 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)OC(C)C(=O)Nc2ccc(N(C)C)cc2)cc1C |
| InChI | InChI=1S/C22H27N3O4/c1-14-6-7-17(12-15(14)2)22(28)23-13-20(26)29-16(3)21(27)24-18-8-10-19(11-9-18)25(4)5/h6-12,16H,13H2,1-5H3,(H,23,28)(H,24,27) |
| InChIKey | SZKRQGYRRJOYIO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate?
The IUPAC name of [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate (CID 3984161) is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate.
What is the SMILES notation for [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate?
The canonical SMILES for [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate is Cc1ccc(C(=O)NCC(=O)OC(C)C(=O)Nc2ccc(N(C)C)cc2)cc1C.
What is the InChIKey of [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate?
The InChIKey is SZKRQGYRRJOYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O4/c1-14-6-7-17(12-15(14)2)22(28)23-13-20(26)29-16(3)21(27)24-18-8-10-19(11-9-18)25(4)5/h6-12,16H,13H2,1-5H3,(H,23,28)(H,24,27).
What are the key properties of [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate?
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate has a molecular weight of 397.48 g/mol, XLogP of 2.67, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 2-[(3,4-dimethylbenzoyl)amino]acetate is sourced from PubChem (CID 3984161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).