C18H23ClN8S — CID 39841738
2-N-[(2S)-butan-2-yl]-6-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-1-yl]-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 39841738) has the molecular formula C18H23ClN8S and a molecular weight of 418.96 g/mol. Its IUPAC name is 2-N-[(2S)-butan-2-yl]-6-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-1-yl]-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(2S)-butan-2-yl]-6-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-1-yl]-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 39841738 |
| Molecular Formula | C18H23ClN8S |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-N-[(2S)-butan-2-yl]-6-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-1-yl]-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC[C@H](C)Nc1nc(N(C)C)nc(-n2cnc(SCc3ccc(Cl)cc3)n2)n1 |
| InChI | InChI=1S/C18H23ClN8S/c1-5-12(2)21-15-22-16(26(3)4)24-17(23-15)27-11-20-18(25-27)28-10-13-6-8-14(19)9-7-13/h6-9,11-12H,5,10H2,1-4H3,(H,21,22,23,24)/t12-/m0/s1 |
| InChIKey | ZKEOJJBZMBZXEA-LBPRGKRZSA-N |
| XLogP | 3.67 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |