C12H8Br2N2O — CID 3984426
2,4-dibromo-6-(pyridin-3-yliminomethyl)phenol (PubChem CID 3984426) has the molecular formula C12H8Br2N2O and a molecular weight of 356.02 g/mol. Its IUPAC name is 2,4-dibromo-6-(pyridin-3-yliminomethyl)phenol.
| Compound Name | 2,4-dibromo-6-(pyridin-3-yliminomethyl)phenol |
|---|---|
| PubChem CID | 3984426 |
| Molecular Formula | C12H8Br2N2O |
| Molecular Weight | 356.02 g/mol |
| Exact Mass | 353.90 |
| IUPAC Name | 2,4-dibromo-6-(pyridin-3-yliminomethyl)phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/c1cccnc1 |
| InChI | InChI=1S/C12H8Br2N2O/c13-9-4-8(12(17)11(14)5-9)6-16-10-2-1-3-15-7-10/h1-7,17H/b16-6+ |
| InChIKey | UPUCMBYGXHVCQK-OMCISZLKSA-N |
| XLogP | 4.06 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.02 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|