C20H17N3O2 — CID 39849384
N-(2-cyanophenyl)-1-ethyl-2-methyl-4-oxoquinoline-6-carboxamide (PubChem CID 39849384) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(2-cyanophenyl)-1-ethyl-2-methyl-4-oxoquinoline-6-carboxamide.
| Compound Name | N-(2-cyanophenyl)-1-ethyl-2-methyl-4-oxoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 39849384 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-(2-cyanophenyl)-1-ethyl-2-methyl-4-oxoquinoline-6-carboxamide |
| SMILES | CCn1c(C)cc(=O)c2cc(C(=O)Nc3ccccc3C#N)ccc21 |
| InChI | InChI=1S/C20H17N3O2/c1-3-23-13(2)10-19(24)16-11-14(8-9-18(16)23)20(25)22-17-7-5-4-6-15(17)12-21/h4-11H,3H2,1-2H3,(H,22,25) |
| InChIKey | QABLOOUYPQEPRR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |