About 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione
2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione (PubChem CID 3985004) has the molecular formula C12H13NS
and a molecular weight of 203.31 g/mol. Its IUPAC name is 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione.
Molecular Properties
| Compound Name | 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione |
| PubChem CID | 3985004 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione |
| SMILES | CC1CC=C(c2ccccc2)C(=S)N1 |
| InChI | InChI=1S/C12H13NS/c1-9-7-8-11(12(14)13-9)10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,13,14) |
| InChIKey | UJEYHIWKFIXAEE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione?
The IUPAC name of 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione (CID 3985004) is 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione.
What is the SMILES notation for 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione?
The canonical SMILES for 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione is CC1CC=C(c2ccccc2)C(=S)N1.
What is the InChIKey of 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione?
The InChIKey is UJEYHIWKFIXAEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NS/c1-9-7-8-11(12(14)13-9)10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,13,14).
What are the key properties of 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione?
2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione has a molecular weight of 203.31 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-phenyl-2,3-dihydro-1H-pyridine-6-thione is sourced from PubChem (CID 3985004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).