C19H17FN2O2 — CID 39850863
N-benzyl-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxamide (PubChem CID 39850863) has the molecular formula C19H17FN2O2 and a molecular weight of 324.36 g/mol. Its IUPAC name is N-benzyl-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxamide.
| Compound Name | N-benzyl-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 39850863 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-benzyl-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)NCc2ccccc2)c(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C19H17FN2O2/c1-2-22-12-16(18(23)15-10-14(20)8-9-17(15)22)19(24)21-11-13-6-4-3-5-7-13/h3-10,12H,2,11H2,1H3,(H,21,24) |
| InChIKey | KKGVEQCGGQSKTO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |