C19H12N4O5S — CID 39853058
(5R)-4-[hydroxy(phenyl)methylidene]-5-(3-nitrophenyl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 39853058) has the molecular formula C19H12N4O5S and a molecular weight of 408.40 g/mol. Its IUPAC name is (5R)-4-[hydroxy(phenyl)methylidene]-5-(3-nitrophenyl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[hydroxy(phenyl)methylidene]-5-(3-nitrophenyl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 39853058 |
| Molecular Formula | C19H12N4O5S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | (5R)-4-[hydroxy(phenyl)methylidene]-5-(3-nitrophenyl)-1-(1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nncs2)[C@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1ccccc1 |
| InChI | InChI=1S/C19H12N4O5S/c24-16(11-5-2-1-3-6-11)14-15(12-7-4-8-13(9-12)23(27)28)22(18(26)17(14)25)19-21-20-10-29-19/h1-10,15,24H/t15-/m1/s1 |
| InChIKey | NRIZMIVFEDATQU-OAHLLOKOSA-N |
| XLogP | 3.07 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|