C19H18FN3O3 — CID 39853089
N-[3-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]-4-methoxybutanamide (PubChem CID 39853089) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-[3-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]-4-methoxybutanamide.
| Compound Name | N-[3-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]-4-methoxybutanamide |
|---|---|
| PubChem CID | 39853089 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[3-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]-4-methoxybutanamide |
| SMILES | COCCCC(=O)Nc1cccc(-c2noc(-c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C19H18FN3O3/c1-25-11-3-6-17(24)21-16-5-2-4-14(12-16)18-22-19(26-23-18)13-7-9-15(20)10-8-13/h2,4-5,7-10,12H,3,6,11H2,1H3,(H,21,24) |
| InChIKey | QUSNEUOIAIOVGK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|