About 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide
3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide (PubChem CID 3985387) has the molecular formula C9H14N4OS
and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide.
Molecular Properties
| Compound Name | 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide |
| PubChem CID | 3985387 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide |
| SMILES | CSCCc1nn(C(N)=O)c2c1CCN2 |
| InChI | InChI=1S/C9H14N4OS/c1-15-5-3-7-6-2-4-11-8(6)13(12-7)9(10)14/h11H,2-5H2,1H3,(H2,10,14) |
| InChIKey | HDDSYWQGNUJLCE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide?
The IUPAC name of 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide (CID 3985387) is 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide.
What is the SMILES notation for 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide?
The canonical SMILES for 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide is CSCCc1nn(C(N)=O)c2c1CCN2.
What is the InChIKey of 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide?
The InChIKey is HDDSYWQGNUJLCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4OS/c1-15-5-3-7-6-2-4-11-8(6)13(12-7)9(10)14/h11H,2-5H2,1H3,(H2,10,14).
What are the key properties of 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide?
3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide has a molecular weight of 226.30 g/mol, XLogP of 0.68, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylsulfanylethyl)-5,6-dihydro-4H-pyrrolo[2,3-c]pyrazole-1-carboxamide is sourced from PubChem (CID 3985387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).