C14H13BrF3N3O — CID 39854418
4-bromo-1-ethyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide (PubChem CID 39854418) has the molecular formula C14H13BrF3N3O and a molecular weight of 376.18 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 39854418 |
| Molecular Formula | C14H13BrF3N3O |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 4-bromo-1-ethyl-N-[[2-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Br)c(C(=O)NCc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H13BrF3N3O/c1-2-21-8-11(15)12(20-21)13(22)19-7-9-5-3-4-6-10(9)14(16,17)18/h3-6,8H,2,7H2,1H3,(H,19,22) |
| InChIKey | CLKLNEHMHPXHKC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |