C12H18N2O4S — CID 39855262
(2S)-N-[(5-methylfuran-2-yl)methyl]-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 39855262) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is (2S)-N-[(5-methylfuran-2-yl)methyl]-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(5-methylfuran-2-yl)methyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 39855262 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (2S)-N-[(5-methylfuran-2-yl)methyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)[C@@H]2CCCN2S(C)(=O)=O)o1 |
| InChI | InChI=1S/C12H18N2O4S/c1-9-5-6-10(18-9)8-13-12(15)11-4-3-7-14(11)19(2,16)17/h5-6,11H,3-4,7-8H2,1-2H3,(H,13,15)/t11-/m0/s1 |
| InChIKey | GEHRFNOXMUXDEA-NSHDSACASA-N |
| XLogP | 0.63 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |