C18H14N2O2 — CID 39857899
N-quinolin-3-yl-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 39857899) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-quinolin-3-yl-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-quinolin-3-yl-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 39857899 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-quinolin-3-yl-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | O=C(Nc1cnc2ccccc2c1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C18H14N2O2/c21-18(14-5-6-17-13(9-14)7-8-22-17)20-15-10-12-3-1-2-4-16(12)19-11-15/h1-6,9-11H,7-8H2,(H,20,21) |
| InChIKey | RTYYQFLEYPDHPH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |