methyl 3-(4-methylphenyl)adamantane-1-carboxylate

C19H24O2 — CID 3985939

IUPACmethyl 3-(4-methylphenyl)adamantane-1-carboxylate
SMILESCOC(=O)C12CC3CC(C1)CC(c1ccc(C)cc1)(C3)C2
InChIInChI=1S/C19H24O2/c1-13-3-5-16(6-4-13)18-8-14-7-15(9-18)11-19(10-14,12-18)17(20)21-2/h3-6,14-15H,7-12H2,1-2H3
InChIKeyHTEDSIKOCHFGBH-UHFFFAOYSA-N
MW284.40 g/mol
LogP4.01
Rot. Bonds2

About methyl 3-(4-methylphenyl)adamantane-1-carboxylate

methyl 3-(4-methylphenyl)adamantane-1-carboxylate (PubChem CID 3985939) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is methyl 3-(4-methylphenyl)adamantane-1-carboxylate.

Molecular Properties

Compound Namemethyl 3-(4-methylphenyl)adamantane-1-carboxylate
PubChem CID3985939
Molecular FormulaC19H24O2
Molecular Weight284.40 g/mol
Exact Mass284.18
IUPAC Namemethyl 3-(4-methylphenyl)adamantane-1-carboxylate
SMILESCOC(=O)C12CC3CC(C1)CC(c1ccc(C)cc1)(C3)C2
InChIInChI=1S/C19H24O2/c1-13-3-5-16(6-4-13)18-8-14-7-15(9-18)11-19(10-14,12-18)17(20)21-2/h3-6,14-15H,7-12H2,1-2H3
InChIKeyHTEDSIKOCHFGBH-UHFFFAOYSA-N
XLogP4.01
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.40
LogP ≤ 54.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 3-(4-methylphenyl)adamantane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4-methylphenyl)adamantane-1-carboxylate?
The IUPAC name of methyl 3-(4-methylphenyl)adamantane-1-carboxylate (CID 3985939) is methyl 3-(4-methylphenyl)adamantane-1-carboxylate.
What is the SMILES notation for methyl 3-(4-methylphenyl)adamantane-1-carboxylate?
The canonical SMILES for methyl 3-(4-methylphenyl)adamantane-1-carboxylate is COC(=O)C12CC3CC(C1)CC(c1ccc(C)cc1)(C3)C2.
What is the InChIKey of methyl 3-(4-methylphenyl)adamantane-1-carboxylate?
The InChIKey is HTEDSIKOCHFGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O2/c1-13-3-5-16(6-4-13)18-8-14-7-15(9-18)11-19(10-14,12-18)17(20)21-2/h3-6,14-15H,7-12H2,1-2H3.
What are the key properties of methyl 3-(4-methylphenyl)adamantane-1-carboxylate?
methyl 3-(4-methylphenyl)adamantane-1-carboxylate has a molecular weight of 284.40 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-methylphenyl)adamantane-1-carboxylate is sourced from PubChem (CID 3985939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).