C18H18FN3O3S — CID 39860929
N-[(4-cyanophenyl)methyl]-3-[(4-fluorophenyl)sulfonylamino]-N-methylpropanamide (PubChem CID 39860929) has the molecular formula C18H18FN3O3S and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-3-[(4-fluorophenyl)sulfonylamino]-N-methylpropanamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-3-[(4-fluorophenyl)sulfonylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 39860929 |
| Molecular Formula | C18H18FN3O3S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-3-[(4-fluorophenyl)sulfonylamino]-N-methylpropanamide |
| SMILES | CN(Cc1ccc(C#N)cc1)C(=O)CCNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN3O3S/c1-22(13-15-4-2-14(12-20)3-5-15)18(23)10-11-21-26(24,25)17-8-6-16(19)7-9-17/h2-9,21H,10-11,13H2,1H3 |
| InChIKey | XYVNNSMHLQZHFA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |