C20H20N2O5S2 — CID 3986122
N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-thiophen-2-ylacetamide (PubChem CID 3986122) has the molecular formula C20H20N2O5S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 3986122 |
| Molecular Formula | C20H20N2O5S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-[2-methoxy-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-thiophen-2-ylacetamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2OC)cc1NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C20H20N2O5S2/c1-26-18-8-4-3-7-16(18)22-29(24,25)15-9-10-19(27-2)17(13-15)21-20(23)12-14-6-5-11-28-14/h3-11,13,22H,12H2,1-2H3,(H,21,23) |
| InChIKey | JJGPULKFZXUKJH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |