C17H27N3O4 — CID 3986277
3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 3986277) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 3986277 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3-[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | CC1CN(C(=O)CN2C(=O)NC3(CCCCCC3)C2=O)CC(C)O1 |
| InChI | InChI=1S/C17H27N3O4/c1-12-9-19(10-13(2)24-12)14(21)11-20-15(22)17(18-16(20)23)7-5-3-4-6-8-17/h12-13H,3-11H2,1-2H3,(H,18,23) |
| InChIKey | WRLLFZQYISGQLD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|