C21H22N4O3S2 — CID 39868407
5-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione (PubChem CID 39868407) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 5-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione.
| Compound Name | 5-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
|---|---|
| PubChem CID | 39868407 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 5-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
| SMILES | COc1ccc([C@@H](Cn2cnc3c4c(sc3c2=O)SCC(=O)N4)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H22N4O3S2/c1-28-14-6-4-13(5-7-14)15(24-8-2-3-9-24)10-25-12-22-17-18-21(29-11-16(26)23-18)30-19(17)20(25)27/h4-7,12,15H,2-3,8-11H2,1H3,(H,23,26)/t15-/m1/s1 |
| InChIKey | ZIQOJWBCDKUWJQ-OAHLLOKOSA-N |
| XLogP | 3.35 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |