C22H17N3O3S — CID 39868533
N-[2-benzamido-4-(4-methylphenyl)-1,3-thiazol-5-yl]furan-2-carboxamide (PubChem CID 39868533) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[2-benzamido-4-(4-methylphenyl)-1,3-thiazol-5-yl]furan-2-carboxamide.
| Compound Name | N-[2-benzamido-4-(4-methylphenyl)-1,3-thiazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39868533 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[2-benzamido-4-(4-methylphenyl)-1,3-thiazol-5-yl]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2nc(NC(=O)c3ccccc3)sc2NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C22H17N3O3S/c1-14-9-11-15(12-10-14)18-21(24-20(27)17-8-5-13-28-17)29-22(23-18)25-19(26)16-6-3-2-4-7-16/h2-13H,1H3,(H,24,27)(H,23,25,26) |
| InChIKey | OBNQPQJYDTWNKW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |