About 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine
5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine (PubChem CID 39869478) has the molecular formula C13H15N5S
and a molecular weight of 273.37 g/mol. Its IUPAC name is 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine |
| PubChem CID | 39869478 |
| Molecular Formula | C13H15N5S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine |
| SMILES | NCCCc1[nH]nc(N)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H15N5S/c14-7-3-5-9-11(12(15)18-17-9)13-16-8-4-1-2-6-10(8)19-13/h1-2,4,6H,3,5,7,14H2,(H3,15,17,18) |
| InChIKey | YHCLQAVKRVLZRL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine?
The IUPAC name of 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine (CID 39869478) is 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine?
The canonical SMILES for 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine is NCCCc1[nH]nc(N)c1-c1nc2ccccc2s1.
What is the InChIKey of 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine?
The InChIKey is YHCLQAVKRVLZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5S/c14-7-3-5-9-11(12(15)18-17-9)13-16-8-4-1-2-6-10(8)19-13/h1-2,4,6H,3,5,7,14H2,(H3,15,17,18).
What are the key properties of 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine?
5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine has a molecular weight of 273.37 g/mol, XLogP of 2.16, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-aminopropyl)-4-(1,3-benzothiazol-2-yl)-1H-pyrazol-3-amine is sourced from PubChem (CID 39869478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).