About 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid
2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 39870055) has the molecular formula C9H13NO2S
and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 39870055 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCc1nc(C)c(C(=O)O)s1 |
| InChI | InChI=1S/C9H13NO2S/c1-3-4-5-7-10-6(2)8(13-7)9(11)12/h3-5H2,1-2H3,(H,11,12) |
| InChIKey | LJKKXYIDMGLOKA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid (CID 39870055) is 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid is CCCCc1nc(C)c(C(=O)O)s1.
What is the InChIKey of 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is LJKKXYIDMGLOKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-3-4-5-7-10-6(2)8(13-7)9(11)12/h3-5H2,1-2H3,(H,11,12).
What are the key properties of 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid?
2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 199.28 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 39870055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).