About 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline
3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline (PubChem CID 39871074) has the molecular formula C12H19FN3+
and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline.
Molecular Properties
| Compound Name | 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline |
| PubChem CID | 39871074 |
| Molecular Formula | C12H19FN3+ |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline |
| SMILES | C[NH+]1CCCN(c2ccc(N)cc2F)CC1 |
| InChI | InChI=1S/C12H18FN3/c1-15-5-2-6-16(8-7-15)12-4-3-10(14)9-11(12)13/h3-4,9H,2,5-8,14H2,1H3/p+1 |
| InChIKey | DZVMBVDQVQEWNT-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 33.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline?
The IUPAC name of 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline (CID 39871074) is 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline.
What is the SMILES notation for 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline?
The canonical SMILES for 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline is C[NH+]1CCCN(c2ccc(N)cc2F)CC1.
What is the InChIKey of 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline?
The InChIKey is DZVMBVDQVQEWNT-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H18FN3/c1-15-5-2-6-16(8-7-15)12-4-3-10(14)9-11(12)13/h3-4,9H,2,5-8,14H2,1H3/p+1.
What are the key properties of 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline?
3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline has a molecular weight of 224.30 g/mol, XLogP of 0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-(4-methyl-1,4-diazepan-4-ium-1-yl)aniline is sourced from PubChem (CID 39871074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).