C26H31N5O — CID 3987179
2-amino-1-pentyl-N-(4-phenylbutan-2-yl)pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 3987179) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-amino-1-pentyl-N-(4-phenylbutan-2-yl)pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-1-pentyl-N-(4-phenylbutan-2-yl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 3987179 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 2-amino-1-pentyl-N-(4-phenylbutan-2-yl)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CCCCCn1c(N)c(C(=O)NC(C)CCc2ccccc2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C26H31N5O/c1-3-4-10-17-31-24(27)22(23-25(31)30-21-14-9-8-13-20(21)29-23)26(32)28-18(2)15-16-19-11-6-5-7-12-19/h5-9,11-14,18H,3-4,10,15-17,27H2,1-2H3,(H,28,32) |
| InChIKey | RLJVYTZNUDCFIL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|