C9H13N3O3 — CID 39877725
N-(2-methoxyethyl)-2-(2-oxopyrimidin-1-yl)acetamide (PubChem CID 39877725) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(2-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(2-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 39877725 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-(2-oxopyrimidin-1-yl)acetamide |
| SMILES | COCCNC(=O)Cn1cccnc1=O |
| InChI | InChI=1S/C9H13N3O3/c1-15-6-4-10-8(13)7-12-5-2-3-11-9(12)14/h2-3,5H,4,6-7H2,1H3,(H,10,13) |
| InChIKey | JMZBXDJQZGQDMB-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|