C14H18N4O3 — CID 39877731
N-(2-methoxyethyl)-1-(4-methylphenyl)-6-oxo-2,5-dihydro-1,2,4-triazine-3-carboxamide (PubChem CID 39877731) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-(4-methylphenyl)-6-oxo-2,5-dihydro-1,2,4-triazine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-(4-methylphenyl)-6-oxo-2,5-dihydro-1,2,4-triazine-3-carboxamide |
|---|---|
| PubChem CID | 39877731 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-(2-methoxyethyl)-1-(4-methylphenyl)-6-oxo-2,5-dihydro-1,2,4-triazine-3-carboxamide |
| SMILES | COCCNC(=O)C1=NCC(=O)N(c2ccc(C)cc2)N1 |
| InChI | InChI=1S/C14H18N4O3/c1-10-3-5-11(6-4-10)18-12(19)9-16-13(17-18)14(20)15-7-8-21-2/h3-6H,7-9H2,1-2H3,(H,15,20)(H,16,17) |
| InChIKey | OUHPBJIBMRNIRA-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|