C18H23BrN2O3S2 — CID 39879766
N-[(3aR,6aS)-3-(4-bromo-2,6-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]pentanamide (PubChem CID 39879766) has the molecular formula C18H23BrN2O3S2 and a molecular weight of 459.43 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-(4-bromo-2,6-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]pentanamide.
| Compound Name | N-[(3aR,6aS)-3-(4-bromo-2,6-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]pentanamide |
|---|---|
| PubChem CID | 39879766 |
| Molecular Formula | C18H23BrN2O3S2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | N-[(3aR,6aS)-3-(4-bromo-2,6-dimethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]pentanamide |
| SMILES | CCCCC(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C18H23BrN2O3S2/c1-4-5-6-16(22)20-18-21(14-9-26(23,24)10-15(14)25-18)17-11(2)7-13(19)8-12(17)3/h7-8,14-15H,4-6,9-10H2,1-3H3/b20-18-/t14-,15-/m1/s1 |
| InChIKey | KWOQPACKRGRMNE-PLGXQAJASA-N |
| XLogP | 3.86 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|