C22H13F3N2O4 — CID 3987996
N-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-2,2,2-trifluoroacetamide (PubChem CID 3987996) has the molecular formula C22H13F3N2O4 and a molecular weight of 426.35 g/mol. Its IUPAC name is N-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 3987996 |
| Molecular Formula | C22H13F3N2O4 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[3-(1,3-dioxo-2-phenylisoindol-5-yl)oxyphenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1c2ccc(Oc3cccc(NC(=O)C(F)(F)F)c3)cc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C22H13F3N2O4/c23-22(24,25)21(30)26-13-5-4-8-15(11-13)31-16-9-10-17-18(12-16)20(29)27(19(17)28)14-6-2-1-3-7-14/h1-12H,(H,26,30) |
| InChIKey | SOUSYNBDHNBOIJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|