C15H16ClFN2O3S2 — CID 39882405
N-[(3aS,6aS)-3-(4-chloro-3-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide (PubChem CID 39882405) has the molecular formula C15H16ClFN2O3S2 and a molecular weight of 390.89 g/mol. Its IUPAC name is N-[(3aS,6aS)-3-(4-chloro-3-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide.
| Compound Name | N-[(3aS,6aS)-3-(4-chloro-3-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 39882405 |
| Molecular Formula | C15H16ClFN2O3S2 |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | N-[(3aS,6aS)-3-(4-chloro-3-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide |
| SMILES | CCCC(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H16ClFN2O3S2/c1-2-3-14(20)18-15-19(9-4-5-10(16)11(17)6-9)12-7-24(21,22)8-13(12)23-15/h4-6,12-13H,2-3,7-8H2,1H3/b18-15-/t12-,13+/m0/s1 |
| InChIKey | RFCRSZOUEOLKBI-PQKGRCELSA-N |
| XLogP | 2.88 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|