C20H21FN2O2S2 — CID 39883242
(3aR,6aR)-3-(3,4-dimethylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 39883242) has the molecular formula C20H21FN2O2S2 and a molecular weight of 404.53 g/mol. Its IUPAC name is (3aR,6aR)-3-(3,4-dimethylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aR,6aR)-3-(3,4-dimethylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 39883242 |
| Molecular Formula | C20H21FN2O2S2 |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (3aR,6aR)-3-(3,4-dimethylphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | Cc1ccc(N2C(SCc3ccc(F)cc3)=N[C@H]3CS(=O)(=O)C[C@@H]32)cc1C |
| InChI | InChI=1S/C20H21FN2O2S2/c1-13-3-8-17(9-14(13)2)23-19-12-27(24,25)11-18(19)22-20(23)26-10-15-4-6-16(21)7-5-15/h3-9,18-19H,10-12H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | RENDRAPCNURYKD-OALUTQOASA-N |
| XLogP | 3.72 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |