C20H21ClN2O2S2 — CID 39884287
(3aS,6aS)-2-[(3-chlorophenyl)methylsulfanyl]-3-(2,5-dimethylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 39884287) has the molecular formula C20H21ClN2O2S2 and a molecular weight of 420.99 g/mol. Its IUPAC name is (3aS,6aS)-2-[(3-chlorophenyl)methylsulfanyl]-3-(2,5-dimethylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | (3aS,6aS)-2-[(3-chlorophenyl)methylsulfanyl]-3-(2,5-dimethylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 39884287 |
| Molecular Formula | C20H21ClN2O2S2 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (3aS,6aS)-2-[(3-chlorophenyl)methylsulfanyl]-3-(2,5-dimethylphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | Cc1ccc(C)c(N2C(SCc3cccc(Cl)c3)=N[C@@H]3CS(=O)(=O)C[C@H]32)c1 |
| InChI | InChI=1S/C20H21ClN2O2S2/c1-13-6-7-14(2)18(8-13)23-19-12-27(24,25)11-17(19)22-20(23)26-10-15-4-3-5-16(21)9-15/h3-9,17,19H,10-12H2,1-2H3/t17-,19-/m1/s1 |
| InChIKey | UNZNWGSFVHGRLP-IEBWSBKVSA-N |
| XLogP | 4.23 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |