methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate

C9H15NO5S — CID 39884592

IUPACmethyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate
SMILESCOC(=O)CN(C(C)=O)[C@@H]1CCS(=O)(=O)C1
InChIInChI=1S/C9H15NO5S/c1-7(11)10(5-9(12)15-2)8-3-4-16(13,14)6-8/h8H,3-6H2,1-2H3/t8-/m1/s1
InChIKeyPJULOANXFUUJDK-MRVPVSSYSA-N
MW249.29 g/mol
LogP-0.81
Rot. Bonds3

About methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate

methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate (PubChem CID 39884592) has the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. Its IUPAC name is methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate.

Molecular Properties

Compound Namemethyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate
PubChem CID39884592
Molecular FormulaC9H15NO5S
Molecular Weight249.29 g/mol
Exact Mass249.07
IUPAC Namemethyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate
SMILESCOC(=O)CN(C(C)=O)[C@@H]1CCS(=O)(=O)C1
InChIInChI=1S/C9H15NO5S/c1-7(11)10(5-9(12)15-2)8-3-4-16(13,14)6-8/h8H,3-6H2,1-2H3/t8-/m1/s1
InChIKeyPJULOANXFUUJDK-MRVPVSSYSA-N
XLogP-0.81
TPSA80.75 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.29
LogP ≤ 5-0.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate?
The IUPAC name of methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate (CID 39884592) is methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate.
What is the SMILES notation for methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate?
The canonical SMILES for methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate is COC(=O)CN(C(C)=O)[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate?
The InChIKey is PJULOANXFUUJDK-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H15NO5S/c1-7(11)10(5-9(12)15-2)8-3-4-16(13,14)6-8/h8H,3-6H2,1-2H3/t8-/m1/s1.
What are the key properties of methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate?
methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate has a molecular weight of 249.29 g/mol, XLogP of -0.81, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[acetyl-[(3R)-1,1-dioxothiolan-3-yl]amino]acetate is sourced from PubChem (CID 39884592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).