About methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate
methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate (PubChem CID 39884809) has the molecular formula C13H23NO5S
and a molecular weight of 305.40 g/mol. Its IUPAC name is methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate |
| PubChem CID | 39884809 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate |
| SMILES | COC(=O)CCN(C(=O)CC(C)C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H23NO5S/c1-10(2)8-12(15)14(6-4-13(16)19-3)11-5-7-20(17,18)9-11/h10-11H,4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | NGROPYCKYTUITC-NSHDSACASA-N |
| XLogP | 0.61 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate?
The IUPAC name of methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate (CID 39884809) is methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate.
What is the SMILES notation for methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate?
The canonical SMILES for methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate is COC(=O)CCN(C(=O)CC(C)C)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate?
The InChIKey is NGROPYCKYTUITC-NSHDSACASA-N. The full InChI is InChI=1S/C13H23NO5S/c1-10(2)8-12(15)14(6-4-13(16)19-3)11-5-7-20(17,18)9-11/h10-11H,4-9H2,1-3H3/t11-/m0/s1.
What are the key properties of methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate?
methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate has a molecular weight of 305.40 g/mol, XLogP of 0.61, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[(3S)-1,1-dioxothiolan-3-yl]-(3-methylbutanoyl)amino]propanoate is sourced from PubChem (CID 39884809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).