C20H20Cl2O5S — CID 39884998
[(1S,2R,4R)-2-(2,4-dichlorophenoxy)-4-(2,3-dimethylphenyl)-3-oxocyclobutyl]methyl methanesulfonate (PubChem CID 39884998) has the molecular formula C20H20Cl2O5S and a molecular weight of 443.35 g/mol. Its IUPAC name is [(1S,2R,4R)-2-(2,4-dichlorophenoxy)-4-(2,3-dimethylphenyl)-3-oxocyclobutyl]methyl methanesulfonate.
| Compound Name | [(1S,2R,4R)-2-(2,4-dichlorophenoxy)-4-(2,3-dimethylphenyl)-3-oxocyclobutyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 39884998 |
| Molecular Formula | C20H20Cl2O5S |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | [(1S,2R,4R)-2-(2,4-dichlorophenoxy)-4-(2,3-dimethylphenyl)-3-oxocyclobutyl]methyl methanesulfonate |
| SMILES | Cc1cccc([C@@H]2C(=O)[C@H](Oc3ccc(Cl)cc3Cl)[C@@H]2COS(C)(=O)=O)c1C |
| InChI | InChI=1S/C20H20Cl2O5S/c1-11-5-4-6-14(12(11)2)18-15(10-26-28(3,24)25)20(19(18)23)27-17-8-7-13(21)9-16(17)22/h4-9,15,18,20H,10H2,1-3H3/t15-,18+,20-/m1/s1 |
| InChIKey | YEECGHCGMDONKV-MOXGXCLJSA-N |
| XLogP | 4.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|