C17H14FNO4 — CID 39890045
(3R)-3-[2-(2-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one (PubChem CID 39890045) has the molecular formula C17H14FNO4 and a molecular weight of 315.30 g/mol. Its IUPAC name is (3R)-3-[2-(2-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one.
| Compound Name | (3R)-3-[2-(2-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 39890045 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (3R)-3-[2-(2-fluoro-4-methoxyphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
| SMILES | COc1ccc(C(=O)C[C@]2(O)C(=O)Nc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C17H14FNO4/c1-23-10-6-7-11(13(18)8-10)15(20)9-17(22)12-4-2-3-5-14(12)19-16(17)21/h2-8,22H,9H2,1H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | LNTFWIIDPXQLHT-QGZVFWFLSA-N |
| XLogP | 2.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |