C18H25N3O3 — CID 39891647
3,4-diethoxy-N-[(1-ethylpyrazol-4-yl)methyl]-N-methylbenzamide (PubChem CID 39891647) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3,4-diethoxy-N-[(1-ethylpyrazol-4-yl)methyl]-N-methylbenzamide.
| Compound Name | 3,4-diethoxy-N-[(1-ethylpyrazol-4-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 39891647 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 3,4-diethoxy-N-[(1-ethylpyrazol-4-yl)methyl]-N-methylbenzamide |
| SMILES | CCOc1ccc(C(=O)N(C)Cc2cnn(CC)c2)cc1OCC |
| InChI | InChI=1S/C18H25N3O3/c1-5-21-13-14(11-19-21)12-20(4)18(22)15-8-9-16(23-6-2)17(10-15)24-7-3/h8-11,13H,5-7,12H2,1-4H3 |
| InChIKey | GMIDMFASNPPGLB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |