About N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide
N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide (PubChem CID 39892018) has the molecular formula C13H16F2N2O2S
and a molecular weight of 302.35 g/mol. Its IUPAC name is N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide |
| PubChem CID | 39892018 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1c(C)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C13H16F2N2O2S/c1-3-20(18,19)16-5-4-10-8(2)17-13-11(10)6-9(14)7-12(13)15/h6-7,16-17H,3-5H2,1-2H3 |
| InChIKey | ASODCMLSUYLIFZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide?
The IUPAC name of N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide (CID 39892018) is N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide.
What is the SMILES notation for N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide?
The canonical SMILES for N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide is CCS(=O)(=O)NCCc1c(C)[nH]c2c(F)cc(F)cc12.
What is the InChIKey of N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide?
The InChIKey is ASODCMLSUYLIFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2N2O2S/c1-3-20(18,19)16-5-4-10-8(2)17-13-11(10)6-9(14)7-12(13)15/h6-7,16-17H,3-5H2,1-2H3.
What are the key properties of N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide?
N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide has a molecular weight of 302.35 g/mol, XLogP of 2.24, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]ethanesulfonamide is sourced from PubChem (CID 39892018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).