C17H11F3N2O3 — CID 39893097
4-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-quinoline-3-carboxamide (PubChem CID 39893097) has the molecular formula C17H11F3N2O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is 4-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-quinoline-3-carboxamide.
| Compound Name | 4-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 39893097 |
| Molecular Formula | C17H11F3N2O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-oxo-N-[4-(trifluoromethoxy)phenyl]-1H-quinoline-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C17H11F3N2O3/c18-17(19,20)25-11-7-5-10(6-8-11)22-16(24)13-9-21-14-4-2-1-3-12(14)15(13)23/h1-9H,(H,21,23)(H,22,24) |
| InChIKey | DXXLLKRLXPXKJW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |