C17H28N6 — CID 39893229
1,3,5-trimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 39893229) has the molecular formula C17H28N6 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 1,3,5-trimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 39893229 |
| Molecular Formula | C17H28N6 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 1,3,5-trimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Cc1nc(NC2CC(C)(C)NC(C)(C)C2)c2c(n1)c(C)nn2C |
| InChI | InChI=1S/C17H28N6/c1-10-13-14(23(7)21-10)15(19-11(2)18-13)20-12-8-16(3,4)22-17(5,6)9-12/h12,22H,8-9H2,1-7H3,(H,18,19,20) |
| InChIKey | IJWQPUYDVYRDGK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |