C15H21N7 — CID 39893640
5-ethyl-1,3-dimethyl-N-(3-pyrazol-1-ylpropyl)pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 39893640) has the molecular formula C15H21N7 and a molecular weight of 299.38 g/mol. Its IUPAC name is 5-ethyl-1,3-dimethyl-N-(3-pyrazol-1-ylpropyl)pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-ethyl-1,3-dimethyl-N-(3-pyrazol-1-ylpropyl)pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 39893640 |
| Molecular Formula | C15H21N7 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 5-ethyl-1,3-dimethyl-N-(3-pyrazol-1-ylpropyl)pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCc1nc(NCCCn2cccn2)c2c(n1)c(C)nn2C |
| InChI | InChI=1S/C15H21N7/c1-4-12-18-13-11(2)20-21(3)14(13)15(19-12)16-7-5-9-22-10-6-8-17-22/h6,8,10H,4-5,7,9H2,1-3H3,(H,16,18,19) |
| InChIKey | DZWVVEUYSBNZQB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|