C24H20Cl2N6O4S — CID 3989437
1-[[4-(2,5-dichlorophenyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-(4-nitrophenyl)urea (PubChem CID 3989437) has the molecular formula C24H20Cl2N6O4S and a molecular weight of 559.44 g/mol. Its IUPAC name is 1-[[4-(2,5-dichlorophenyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[[4-(2,5-dichlorophenyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 3989437 |
| Molecular Formula | C24H20Cl2N6O4S |
| Molecular Weight | 559.44 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | 1-[[4-(2,5-dichlorophenyl)-5-[(3-methoxyphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-(4-nitrophenyl)urea |
| SMILES | COc1cccc(CSc2nnc(CNC(=O)Nc3ccc([N+](=O)[O-])cc3)n2-c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C24H20Cl2N6O4S/c1-36-19-4-2-3-15(11-19)14-37-24-30-29-22(31(24)21-12-16(25)5-10-20(21)26)13-27-23(33)28-17-6-8-18(9-7-17)32(34)35/h2-12H,13-14H2,1H3,(H2,27,28,33) |
| InChIKey | WRBRDUFSQFBZOQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|