About [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate
[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate (PubChem CID 3989494) has the molecular formula C21H25NO3
and a molecular weight of 339.44 g/mol. Its IUPAC name is [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate.
Molecular Properties
| Compound Name | [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate |
| PubChem CID | 3989494 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate |
| SMILES | CC(C)(C)C1=CC(=NOC(=O)c2ccccc2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C21H25NO3/c1-20(2,3)16-12-15(13-17(18(16)23)21(4,5)6)22-25-19(24)14-10-8-7-9-11-14/h7-13H,1-6H3 |
| InChIKey | SZNYGOGDTIIDQK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate?
The IUPAC name of [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate (CID 3989494) is [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate.
What is the SMILES notation for [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate?
The canonical SMILES for [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate is CC(C)(C)C1=CC(=NOC(=O)c2ccccc2)C=C(C(C)(C)C)C1=O.
What is the InChIKey of [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate?
The InChIKey is SZNYGOGDTIIDQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3/c1-20(2,3)16-12-15(13-17(18(16)23)21(4,5)6)22-25-19(24)14-10-8-7-9-11-14/h7-13H,1-6H3.
What are the key properties of [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate?
[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate has a molecular weight of 339.44 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] benzoate is sourced from PubChem (CID 3989494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).